C21H29N3O3 — CID 21087217
(2,2-dimethyl-1-phenylpropyl) N-hydroxy-N-[3-(pyridin-2-ylmethylamino)propyl]carbamate (PubChem CID 21087217) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is (2,2-dimethyl-1-phenylpropyl) N-hydroxy-N-[3-(pyridin-2-ylmethylamino)propyl]carbamate.
| Compound Name | (2,2-dimethyl-1-phenylpropyl) N-hydroxy-N-[3-(pyridin-2-ylmethylamino)propyl]carbamate |
|---|---|
| PubChem CID | 21087217 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | (2,2-dimethyl-1-phenylpropyl) N-hydroxy-N-[3-(pyridin-2-ylmethylamino)propyl]carbamate |
| SMILES | CC(C)(C)C(OC(=O)N(O)CCCNCc1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C21H29N3O3/c1-21(2,3)19(17-10-5-4-6-11-17)27-20(25)24(26)15-9-13-22-16-18-12-7-8-14-23-18/h4-8,10-12,14,19,22,26H,9,13,15-16H2,1-3H3 |
| InChIKey | SIBHJTPETUCRKV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|