C23H30N6 — CID 102283031
N,N'-bis(pyridin-2-ylmethyl)-N'-[2-(pyridin-2-ylmethylamino)ethyl]propane-1,3-diamine (PubChem CID 102283031) has the molecular formula C23H30N6 and a molecular weight of 390.53 g/mol. Its IUPAC name is N,N'-bis(pyridin-2-ylmethyl)-N'-[2-(pyridin-2-ylmethylamino)ethyl]propane-1,3-diamine.
| Compound Name | N,N'-bis(pyridin-2-ylmethyl)-N'-[2-(pyridin-2-ylmethylamino)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 102283031 |
| Molecular Formula | C23H30N6 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | N,N'-bis(pyridin-2-ylmethyl)-N'-[2-(pyridin-2-ylmethylamino)ethyl]propane-1,3-diamine |
| SMILES | c1ccc(CNCCCN(CCNCc2ccccn2)Cc2ccccn2)nc1 |
| InChI | InChI=1S/C23H30N6/c1-4-12-26-21(8-1)18-24-11-7-16-29(20-23-10-3-6-14-28-23)17-15-25-19-22-9-2-5-13-27-22/h1-6,8-10,12-14,24-25H,7,11,15-20H2 |
| InChIKey | RPYGRPPLOAQXJO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|