C18H28N6 — CID 102390835
N',N'-bis[2-(pyridin-2-ylmethylamino)ethyl]ethane-1,2-diamine (PubChem CID 102390835) has the molecular formula C18H28N6 and a molecular weight of 328.46 g/mol. Its IUPAC name is N',N'-bis[2-(pyridin-2-ylmethylamino)ethyl]ethane-1,2-diamine.
| Compound Name | N',N'-bis[2-(pyridin-2-ylmethylamino)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 102390835 |
| Molecular Formula | C18H28N6 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | N',N'-bis[2-(pyridin-2-ylmethylamino)ethyl]ethane-1,2-diamine |
| SMILES | NCCN(CCNCc1ccccn1)CCNCc1ccccn1 |
| InChI | InChI=1S/C18H28N6/c19-7-12-24(13-10-20-15-17-5-1-3-8-22-17)14-11-21-16-18-6-2-4-9-23-18/h1-6,8-9,20-21H,7,10-16,19H2 |
| InChIKey | HRTINDXDSQHFBK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|