C14H23ClN2 — CID 4712070
N-[(3-chlorophenyl)methyl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 4712070) has the molecular formula C14H23ClN2 and a molecular weight of 254.80 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[(3-chlorophenyl)methyl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 4712070 |
| Molecular Formula | C14H23ClN2 |
| Molecular Weight | 254.80 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNCc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H23ClN2/c1-3-17(4-2)10-6-9-16-12-13-7-5-8-14(15)11-13/h5,7-8,11,16H,3-4,6,9-10,12H2,1-2H3 |
| InChIKey | IWRQENNACKYQTN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.80 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|