C14H25BrCl2N2 — CID 17215009
N-[(3-bromophenyl)methyl]-N',N'-diethylpropane-1,3-diamine;dihydrochloride (PubChem CID 17215009) has the molecular formula C14H25BrCl2N2 and a molecular weight of 372.18 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-N',N'-diethylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N-[(3-bromophenyl)methyl]-N',N'-diethylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17215009 |
| Molecular Formula | C14H25BrCl2N2 |
| Molecular Weight | 372.18 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-N',N'-diethylpropane-1,3-diamine;dihydrochloride |
| SMILES | CCN(CC)CCCNCc1cccc(Br)c1.Cl.Cl |
| InChI | InChI=1S/C14H23BrN2.2ClH/c1-3-17(4-2)10-6-9-16-12-13-7-5-8-14(15)11-13;;/h5,7-8,11,16H,3-4,6,9-10,12H2,1-2H3;2*1H |
| InChIKey | BTLMYLGUXBBCBB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.18 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|