C18H33BrCl2N2 — CID 17214537
N-[(3-bromophenyl)methyl]-N',N'-dibutylpropane-1,3-diamine;dihydrochloride (PubChem CID 17214537) has the molecular formula C18H33BrCl2N2 and a molecular weight of 428.29 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-N',N'-dibutylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N-[(3-bromophenyl)methyl]-N',N'-dibutylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17214537 |
| Molecular Formula | C18H33BrCl2N2 |
| Molecular Weight | 428.29 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-N',N'-dibutylpropane-1,3-diamine;dihydrochloride |
| SMILES | CCCCN(CCCC)CCCNCc1cccc(Br)c1.Cl.Cl |
| InChI | InChI=1S/C18H31BrN2.2ClH/c1-3-5-12-21(13-6-4-2)14-8-11-20-16-17-9-7-10-18(19)15-17;;/h7,9-10,15,20H,3-6,8,11-14,16H2,1-2H3;2*1H |
| InChIKey | VKKDRPKRCKCGHZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.29 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|