2-[(3-bromophenyl)methylamino]ethanol chloride

C9H12BrClNO- — CID 53350733

IUPAC2-[(3-bromophenyl)methylamino]ethanol chloride
SMILESOCCNCc1cccc(Br)c1.[Cl-]
InChIInChI=1S/C9H12BrNO.ClH/c10-9-3-1-2-8(6-9)7-11-4-5-12;/h1-3,6,11-12H,4-5,7H2;1H/p-1
InChIKeyVKKKSWADFKXSBB-UHFFFAOYSA-M
MW265.56 g/mol
LogP-1.47
Rot. Bonds4

About 2-[(3-bromophenyl)methylamino]ethanol chloride

2-[(3-bromophenyl)methylamino]ethanol chloride (PubChem CID 53350733) has the molecular formula C9H12BrClNO- and a molecular weight of 265.56 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methylamino]ethanol chloride.

Molecular Properties

Compound Name2-[(3-bromophenyl)methylamino]ethanol chloride
PubChem CID53350733
Molecular FormulaC9H12BrClNO-
Molecular Weight265.56 g/mol
Exact Mass263.98
IUPAC Name2-[(3-bromophenyl)methylamino]ethanol chloride
SMILESOCCNCc1cccc(Br)c1.[Cl-]
InChIInChI=1S/C9H12BrNO.ClH/c10-9-3-1-2-8(6-9)7-11-4-5-12;/h1-3,6,11-12H,4-5,7H2;1H/p-1
InChIKeyVKKKSWADFKXSBB-UHFFFAOYSA-M
XLogP-1.47
TPSA32.26 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.56
LogP ≤ 5-1.47
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[(3-bromophenyl)methylamino]ethanol chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3-bromophenyl)methylamino]ethanol chloride?
The IUPAC name of 2-[(3-bromophenyl)methylamino]ethanol chloride (CID 53350733) is 2-[(3-bromophenyl)methylamino]ethanol chloride.
What is the SMILES notation for 2-[(3-bromophenyl)methylamino]ethanol chloride?
The canonical SMILES for 2-[(3-bromophenyl)methylamino]ethanol chloride is OCCNCc1cccc(Br)c1.[Cl-].
What is the InChIKey of 2-[(3-bromophenyl)methylamino]ethanol chloride?
The InChIKey is VKKKSWADFKXSBB-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H12BrNO.ClH/c10-9-3-1-2-8(6-9)7-11-4-5-12;/h1-3,6,11-12H,4-5,7H2;1H/p-1.
What are the key properties of 2-[(3-bromophenyl)methylamino]ethanol chloride?
2-[(3-bromophenyl)methylamino]ethanol chloride has a molecular weight of 265.56 g/mol, XLogP of -1.47, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-bromophenyl)methylamino]ethanol chloride is sourced from PubChem (CID 53350733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).