C10H13BrN2OS — CID 59050729
1-[(3-bromophenyl)methyl]-3-(2-hydroxyethyl)thiourea (PubChem CID 59050729) has the molecular formula C10H13BrN2OS and a molecular weight of 289.20 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-3-(2-hydroxyethyl)thiourea.
| Compound Name | 1-[(3-bromophenyl)methyl]-3-(2-hydroxyethyl)thiourea |
|---|---|
| PubChem CID | 59050729 |
| Molecular Formula | C10H13BrN2OS |
| Molecular Weight | 289.20 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-3-(2-hydroxyethyl)thiourea |
| SMILES | OCCNC(=S)NCc1cccc(Br)c1 |
| InChI | InChI=1S/C10H13BrN2OS/c11-9-3-1-2-8(6-9)7-13-10(15)12-4-5-14/h1-3,6,14H,4-5,7H2,(H2,12,13,15) |
| InChIKey | ZWDGOTSFCPCYKU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|