About 2-(3-bromophenyl)ethanol
2-(3-bromophenyl)ethanol (PubChem CID 2734090) has the molecular formula C8H9BrO
and a molecular weight of 201.06 g/mol. Its IUPAC name is 2-(3-bromophenyl)ethanol.
Molecular Properties
| Compound Name | 2-(3-bromophenyl)ethanol |
| PubChem CID | 2734090 |
| Molecular Formula | C8H9BrO |
| Molecular Weight | 201.06 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | 2-(3-bromophenyl)ethanol |
| SMILES | OCCc1cccc(Br)c1 |
| InChI | InChI=1S/C8H9BrO/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6,10H,4-5H2 |
| InChIKey | PTTFLKHCSZSFOL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.06 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3-bromophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromophenyl)ethanol?
The IUPAC name of 2-(3-bromophenyl)ethanol (CID 2734090) is 2-(3-bromophenyl)ethanol.
What is the SMILES notation for 2-(3-bromophenyl)ethanol?
The canonical SMILES for 2-(3-bromophenyl)ethanol is OCCc1cccc(Br)c1.
What is the InChIKey of 2-(3-bromophenyl)ethanol?
The InChIKey is PTTFLKHCSZSFOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrO/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6,10H,4-5H2.
What are the key properties of 2-(3-bromophenyl)ethanol?
2-(3-bromophenyl)ethanol has a molecular weight of 201.06 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromophenyl)ethanol is sourced from PubChem (CID 2734090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).