C18H30N4S4 — CID 18208247
1-(3-methylsulfanylpropyl)-3-[[3-[(3-methylsulfanylpropylcarbamothioylamino)methyl]phenyl]methyl]thiourea (PubChem CID 18208247) has the molecular formula C18H30N4S4 and a molecular weight of 430.73 g/mol. Its IUPAC name is 1-(3-methylsulfanylpropyl)-3-[[3-[(3-methylsulfanylpropylcarbamothioylamino)methyl]phenyl]methyl]thiourea.
| Compound Name | 1-(3-methylsulfanylpropyl)-3-[[3-[(3-methylsulfanylpropylcarbamothioylamino)methyl]phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 18208247 |
| Molecular Formula | C18H30N4S4 |
| Molecular Weight | 430.73 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 1-(3-methylsulfanylpropyl)-3-[[3-[(3-methylsulfanylpropylcarbamothioylamino)methyl]phenyl]methyl]thiourea |
| SMILES | CSCCCNC(=S)NCc1cccc(CNC(=S)NCCCSC)c1 |
| InChI | InChI=1S/C18H30N4S4/c1-25-10-4-8-19-17(23)21-13-15-6-3-7-16(12-15)14-22-18(24)20-9-5-11-26-2/h3,6-7,12H,4-5,8-11,13-14H2,1-2H3,(H2,19,21,23)(H2,20,22,24) |
| InChIKey | KPMYIQHCLVWGFT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.73 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|