C13H20N2S2 — CID 8620147
1-(3,4-dimethylphenyl)-3-(3-methylsulfanylpropyl)thiourea (PubChem CID 8620147) has the molecular formula C13H20N2S2 and a molecular weight of 268.45 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-(3-methylsulfanylpropyl)thiourea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-(3-methylsulfanylpropyl)thiourea |
|---|---|
| PubChem CID | 8620147 |
| Molecular Formula | C13H20N2S2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-(3-methylsulfanylpropyl)thiourea |
| SMILES | CSCCCNC(=S)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C13H20N2S2/c1-10-5-6-12(9-11(10)2)15-13(16)14-7-4-8-17-3/h5-6,9H,4,7-8H2,1-3H3,(H2,14,15,16) |
| InChIKey | LQOMSGCUZBORLP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|