C12H16F2N2OS2 — CID 8616347
1-[4-(difluoromethoxy)phenyl]-3-(3-methylsulfanylpropyl)thiourea (PubChem CID 8616347) has the molecular formula C12H16F2N2OS2 and a molecular weight of 306.40 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-(3-methylsulfanylpropyl)thiourea.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-(3-methylsulfanylpropyl)thiourea |
|---|---|
| PubChem CID | 8616347 |
| Molecular Formula | C12H16F2N2OS2 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-(3-methylsulfanylpropyl)thiourea |
| SMILES | CSCCCNC(=S)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C12H16F2N2OS2/c1-19-8-2-7-15-12(18)16-9-3-5-10(6-4-9)17-11(13)14/h3-6,11H,2,7-8H2,1H3,(H2,15,16,18) |
| InChIKey | UNKXCEMOYFARGI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|