C16H24F2N2OS — CID 8628147
1-[4-(difluoromethoxy)phenyl]-3-(2,4,4-trimethylpentan-2-yl)thiourea (PubChem CID 8628147) has the molecular formula C16H24F2N2OS and a molecular weight of 330.44 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-(2,4,4-trimethylpentan-2-yl)thiourea.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-(2,4,4-trimethylpentan-2-yl)thiourea |
|---|---|
| PubChem CID | 8628147 |
| Molecular Formula | C16H24F2N2OS |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-(2,4,4-trimethylpentan-2-yl)thiourea |
| SMILES | CC(C)(C)CC(C)(C)NC(=S)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H24F2N2OS/c1-15(2,3)10-16(4,5)20-14(22)19-11-6-8-12(9-7-11)21-13(17)18/h6-9,13H,10H2,1-5H3,(H2,19,20,22) |
| InChIKey | VMXOUVPSJDYNCW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|