C12H18N2S2 — CID 2446999
1-(4-methylphenyl)-3-(3-methylsulfanylpropyl)thiourea (PubChem CID 2446999) has the molecular formula C12H18N2S2 and a molecular weight of 254.42 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-(3-methylsulfanylpropyl)thiourea.
| Compound Name | 1-(4-methylphenyl)-3-(3-methylsulfanylpropyl)thiourea |
|---|---|
| PubChem CID | 2446999 |
| Molecular Formula | C12H18N2S2 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 1-(4-methylphenyl)-3-(3-methylsulfanylpropyl)thiourea |
| SMILES | CSCCCNC(=S)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C12H18N2S2/c1-10-4-6-11(7-5-10)14-12(15)13-8-3-9-16-2/h4-7H,3,8-9H2,1-2H3,(H2,13,14,15) |
| InChIKey | NTUXCAYTXFKCDL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|