C18H21ClN2S2 — CID 100696249
1-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-3-(4-methylphenyl)thiourea (PubChem CID 100696249) has the molecular formula C18H21ClN2S2 and a molecular weight of 364.97 g/mol. Its IUPAC name is 1-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-3-(4-methylphenyl)thiourea.
| Compound Name | 1-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 100696249 |
| Molecular Formula | C18H21ClN2S2 |
| Molecular Weight | 364.97 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 1-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-3-(4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NCCCSCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H21ClN2S2/c1-14-3-9-17(10-4-14)21-18(22)20-11-2-12-23-13-15-5-7-16(19)8-6-15/h3-10H,2,11-13H2,1H3,(H2,20,21,22) |
| InChIKey | PVARNJVFQMKIPF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.97 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|