C19H23ClN2OS2 — CID 100696465
1-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-3-(4-ethoxyphenyl)thiourea (PubChem CID 100696465) has the molecular formula C19H23ClN2OS2 and a molecular weight of 394.99 g/mol. Its IUPAC name is 1-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-3-(4-ethoxyphenyl)thiourea.
| Compound Name | 1-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-3-(4-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 100696465 |
| Molecular Formula | C19H23ClN2OS2 |
| Molecular Weight | 394.99 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 1-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-3-(4-ethoxyphenyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)NCCCSCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H23ClN2OS2/c1-2-23-18-10-8-17(9-11-18)22-19(24)21-12-3-13-25-14-15-4-6-16(20)7-5-15/h4-11H,2-3,12-14H2,1H3,(H2,21,22,24) |
| InChIKey | VXFJNJBBHIAOPH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.99 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|