C19H24N2S — CID 100611547
1-(4-ethylphenyl)-3-[3-(4-methylphenyl)propyl]thiourea (PubChem CID 100611547) has the molecular formula C19H24N2S and a molecular weight of 312.48 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-[3-(4-methylphenyl)propyl]thiourea.
| Compound Name | 1-(4-ethylphenyl)-3-[3-(4-methylphenyl)propyl]thiourea |
|---|---|
| PubChem CID | 100611547 |
| Molecular Formula | C19H24N2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-(4-ethylphenyl)-3-[3-(4-methylphenyl)propyl]thiourea |
| SMILES | CCc1ccc(NC(=S)NCCCc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H24N2S/c1-3-16-10-12-18(13-11-16)21-19(22)20-14-4-5-17-8-6-15(2)7-9-17/h6-13H,3-5,14H2,1-2H3,(H2,20,21,22) |
| InChIKey | NQPRZBBCYCCGRU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|