C13H22N2O2S2 — CID 155017531
methane;methyl 3-[(4-methylphenyl)carbamothioylamino]propane-1-sulfinate (PubChem CID 155017531) has the molecular formula C13H22N2O2S2 and a molecular weight of 302.47 g/mol. Its IUPAC name is methane;methyl 3-[(4-methylphenyl)carbamothioylamino]propane-1-sulfinate.
| Compound Name | methane;methyl 3-[(4-methylphenyl)carbamothioylamino]propane-1-sulfinate |
|---|---|
| PubChem CID | 155017531 |
| Molecular Formula | C13H22N2O2S2 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | methane;methyl 3-[(4-methylphenyl)carbamothioylamino]propane-1-sulfinate |
| SMILES | C.COS(=O)CCCNC(=S)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C12H18N2O2S2.CH4/c1-10-4-6-11(7-5-10)14-12(17)13-8-3-9-18(15)16-2;/h4-7H,3,8-9H2,1-2H3,(H2,13,14,17);1H4 |
| InChIKey | IIPUGMMTARMMBQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|