C10H13N2NaO3S2 — CID 24905947
sodium 2-[(4-methylphenyl)carbamothioylamino]ethanesulfonate (PubChem CID 24905947) has the molecular formula C10H13N2NaO3S2 and a molecular weight of 296.35 g/mol. Its IUPAC name is sodium 2-[(4-methylphenyl)carbamothioylamino]ethanesulfonate.
| Compound Name | sodium 2-[(4-methylphenyl)carbamothioylamino]ethanesulfonate |
|---|---|
| PubChem CID | 24905947 |
| Molecular Formula | C10H13N2NaO3S2 |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | sodium 2-[(4-methylphenyl)carbamothioylamino]ethanesulfonate |
| SMILES | Cc1ccc(NC(=S)NCCS(=O)(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C10H14N2O3S2.Na/c1-8-2-4-9(5-3-8)12-10(16)11-6-7-17(13,14)15;/h2-5H,6-7H2,1H3,(H2,11,12,16)(H,13,14,15);/q;+1/p-1 |
| InChIKey | JYAATRXBHZPKKD-UHFFFAOYSA-M |
| XLogP | -2.17 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|