C19H29N5S2 — CID 8600224
1-(3,4-dimethylphenyl)-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]thiourea (PubChem CID 8600224) has the molecular formula C19H29N5S2 and a molecular weight of 391.61 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]thiourea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]thiourea |
|---|---|
| PubChem CID | 8600224 |
| Molecular Formula | C19H29N5S2 |
| Molecular Weight | 391.61 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]thiourea |
| SMILES | CSc1nnc(CCCNC(=S)Nc2ccc(C)c(C)c2)n1CC(C)C |
| InChI | InChI=1S/C19H29N5S2/c1-13(2)12-24-17(22-23-19(24)26-5)7-6-10-20-18(25)21-16-9-8-14(3)15(4)11-16/h8-9,11,13H,6-7,10,12H2,1-5H3,(H2,20,21,25) |
| InChIKey | QJHZIWYMUKLSQJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|