C18H36N6S — CID 111943451
2-methyl-1-(4-methylpentyl)-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine (PubChem CID 111943451) has the molecular formula C18H36N6S and a molecular weight of 368.60 g/mol. Its IUPAC name is 2-methyl-1-(4-methylpentyl)-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine.
| Compound Name | 2-methyl-1-(4-methylpentyl)-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine |
|---|---|
| PubChem CID | 111943451 |
| Molecular Formula | C18H36N6S |
| Molecular Weight | 368.60 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 2-methyl-1-(4-methylpentyl)-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine |
| SMILES | C/N=C(/NCCCc1nnc(SC)n1CC(C)C)NCCCC(C)C |
| InChI | InChI=1S/C18H36N6S/c1-14(2)9-7-11-20-17(19-5)21-12-8-10-16-22-23-18(25-6)24(16)13-15(3)4/h14-15H,7-13H2,1-6H3,(H2,19,20,21) |
| InChIKey | LIDGSIAIBWYYOB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.60 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|