C15H27F3N6S — CID 109474991
2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109474991) has the molecular formula C15H27F3N6S and a molecular weight of 380.48 g/mol. Its IUPAC name is 2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109474991 |
| Molecular Formula | C15H27F3N6S |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(/NCCCc1nnc(SC)n1CC(C)C)NCCC(F)(F)F |
| InChI | InChI=1S/C15H27F3N6S/c1-11(2)10-24-12(22-23-14(24)25-4)6-5-8-20-13(19-3)21-9-7-15(16,17)18/h11H,5-10H2,1-4H3,(H2,19,20,21) |
| InChIKey | QQDVAIHXQGPATP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|