C17H35IN6S2 — CID 111629373
2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-(4-methylsulfanylbutyl)guanidine;hydroiodide (PubChem CID 111629373) has the molecular formula C17H35IN6S2 and a molecular weight of 514.55 g/mol. Its IUPAC name is 2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-(4-methylsulfanylbutyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-(4-methylsulfanylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111629373 |
| Molecular Formula | C17H35IN6S2 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-(4-methylsulfanylbutyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCCSC)NCCCc1nnc(SC)n1CC(C)C.I |
| InChI | InChI=1S/C17H34N6S2.HI/c1-14(2)13-23-15(21-22-17(23)25-5)9-8-11-20-16(18-3)19-10-6-7-12-24-4;/h14H,6-13H2,1-5H3,(H2,18,19,20);1H |
| InChIKey | MDMASOZGDAZICY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|