C17H34N6S — CID 111128445
2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-pentylguanidine (PubChem CID 111128445) has the molecular formula C17H34N6S and a molecular weight of 354.57 g/mol. Its IUPAC name is 2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-pentylguanidine.
| Compound Name | 2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-pentylguanidine |
|---|---|
| PubChem CID | 111128445 |
| Molecular Formula | C17H34N6S |
| Molecular Weight | 354.57 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | 2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-pentylguanidine |
| SMILES | CCCCCN/C(=N\C)NCCCc1nnc(SC)n1CC(C)C |
| InChI | InChI=1S/C17H34N6S/c1-6-7-8-11-19-16(18-4)20-12-9-10-15-21-22-17(24-5)23(15)13-14(2)3/h14H,6-13H2,1-5H3,(H2,18,19,20) |
| InChIKey | VIGRCGWRAMISLZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.57 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|