C17H35IN6S — CID 111158230
1-butyl-1,2-dimethyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide (PubChem CID 111158230) has the molecular formula C17H35IN6S and a molecular weight of 482.48 g/mol. Its IUPAC name is 1-butyl-1,2-dimethyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide.
| Compound Name | 1-butyl-1,2-dimethyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111158230 |
| Molecular Formula | C17H35IN6S |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 1-butyl-1,2-dimethyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide |
| SMILES | CCCCN(C)/C(=N\C)NCCCc1nnc(SC)n1CC(C)C.I |
| InChI | InChI=1S/C17H34N6S.HI/c1-7-8-12-22(5)16(18-4)19-11-9-10-15-20-21-17(24-6)23(15)13-14(2)3;/h14H,7-13H2,1-6H3,(H,18,19);1H |
| InChIKey | LBMMLFHMPXKMLQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|