C20H33IN6S — CID 110951787
1-benzyl-1,2-dimethyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide (PubChem CID 110951787) has the molecular formula C20H33IN6S and a molecular weight of 516.50 g/mol. Its IUPAC name is 1-benzyl-1,2-dimethyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide.
| Compound Name | 1-benzyl-1,2-dimethyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110951787 |
| Molecular Formula | C20H33IN6S |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 1-benzyl-1,2-dimethyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1nnc(SC)n1CC(C)C)N(C)Cc1ccccc1.I |
| InChI | InChI=1S/C20H32N6S.HI/c1-16(2)14-26-18(23-24-20(26)27-5)12-9-13-22-19(21-3)25(4)15-17-10-7-6-8-11-17;/h6-8,10-11,16H,9,12-15H2,1-5H3,(H,21,22);1H |
| InChIKey | MEPBTQZTHIBZGY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|