C20H31FN6S — CID 111307336
1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine (PubChem CID 111307336) has the molecular formula C20H31FN6S and a molecular weight of 406.58 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine |
|---|---|
| PubChem CID | 111307336 |
| Molecular Formula | C20H31FN6S |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine |
| SMILES | C/N=C(\NCCCc1nnc(SC)n1CC(C)C)N(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H31FN6S/c1-15(2)13-27-18(24-25-20(27)28-5)7-6-12-23-19(22-3)26(4)14-16-8-10-17(21)11-9-16/h8-11,15H,6-7,12-14H2,1-5H3,(H,22,23) |
| InChIKey | PPZFYRBGAGDGJN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|