C19H28F2N6S — CID 111902859
1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine (PubChem CID 111902859) has the molecular formula C19H28F2N6S and a molecular weight of 410.54 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine |
|---|---|
| PubChem CID | 111902859 |
| Molecular Formula | C19H28F2N6S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine |
| SMILES | C/N=C(\NCCCc1nnc(SC)n1CC(C)C)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C19H28F2N6S/c1-13(2)12-27-17(25-26-19(27)28-4)6-5-9-23-18(22-3)24-11-14-10-15(20)7-8-16(14)21/h7-8,10,13H,5-6,9,11-12H2,1-4H3,(H2,22,23,24) |
| InChIKey | GGCHSPUQSVLOHA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|