C21H34FIN6OS — CID 111684875
1-[2-(2-fluorophenoxy)propyl]-2-methyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide (PubChem CID 111684875) has the molecular formula C21H34FIN6OS and a molecular weight of 564.51 g/mol. Its IUPAC name is 1-[2-(2-fluorophenoxy)propyl]-2-methyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2-fluorophenoxy)propyl]-2-methyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111684875 |
| Molecular Formula | C21H34FIN6OS |
| Molecular Weight | 564.51 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | 1-[2-(2-fluorophenoxy)propyl]-2-methyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1nnc(SC)n1CC(C)C)NCC(C)Oc1ccccc1F.I |
| InChI | InChI=1S/C21H33FN6OS.HI/c1-15(2)14-28-19(26-27-21(28)30-5)11-8-12-24-20(23-4)25-13-16(3)29-18-10-7-6-9-17(18)22;/h6-7,9-10,15-16H,8,11-14H2,1-5H3,(H2,23,24,25);1H |
| InChIKey | RAGQWPSULYKIRN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|