C15H28N6S — CID 110982761
2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-prop-2-enylguanidine (PubChem CID 110982761) has the molecular formula C15H28N6S and a molecular weight of 324.50 g/mol. Its IUPAC name is 2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-prop-2-enylguanidine.
| Compound Name | 2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 110982761 |
| Molecular Formula | C15H28N6S |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\C)NCCCc1nnc(SC)n1CC(C)C |
| InChI | InChI=1S/C15H28N6S/c1-6-9-17-14(16-4)18-10-7-8-13-19-20-15(22-5)21(13)11-12(2)3/h6,12H,1,7-11H2,2-5H3,(H2,16,17,18) |
| InChIKey | CUIIEDKNBUKJNJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|