C19H29N9S — CID 111016163
2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111016163) has the molecular formula C19H29N9S and a molecular weight of 415.57 g/mol. Its IUPAC name is 2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111016163 |
| Molecular Formula | C19H29N9S |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | C/N=C(\NCCCc1nnc(SC)n1CC(C)C)NCc1nnc2ccccn12 |
| InChI | InChI=1S/C19H29N9S/c1-14(2)13-28-16(24-26-19(28)29-4)9-7-10-21-18(20-3)22-12-17-25-23-15-8-5-6-11-27(15)17/h5-6,8,11,14H,7,9-10,12-13H2,1-4H3,(H2,20,21,22) |
| InChIKey | GBCLNPJCQYABOG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 97.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|