C22H32IN7OS — CID 111552063
2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111552063) has the molecular formula C22H32IN7OS and a molecular weight of 569.52 g/mol. Its IUPAC name is 2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111552063 |
| Molecular Formula | C22H32IN7OS |
| Molecular Weight | 569.52 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | 2-methyl-1-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1nnc(SC)n1CC(C)C)NCc1coc(-c2ccccc2)n1.I |
| InChI | InChI=1S/C22H31N7OS.HI/c1-16(2)14-29-19(27-28-22(29)31-4)11-8-12-24-21(23-3)25-13-18-15-30-20(26-18)17-9-6-5-7-10-17;/h5-7,9-10,15-16H,8,11-14H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | VABYHNXNWBXHLG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|