C18H26N6O3S — CID 112840002
1-(3-methyl-4-nitrophenyl)-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]urea (PubChem CID 112840002) has the molecular formula C18H26N6O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is 1-(3-methyl-4-nitrophenyl)-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]urea.
| Compound Name | 1-(3-methyl-4-nitrophenyl)-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]urea |
|---|---|
| PubChem CID | 112840002 |
| Molecular Formula | C18H26N6O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 1-(3-methyl-4-nitrophenyl)-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]urea |
| SMILES | CSc1nnc(CCCNC(=O)Nc2ccc([N+](=O)[O-])c(C)c2)n1CC(C)C |
| InChI | InChI=1S/C18H26N6O3S/c1-12(2)11-23-16(21-22-18(23)28-4)6-5-9-19-17(25)20-14-7-8-15(24(26)27)13(3)10-14/h7-8,10,12H,5-6,9,11H2,1-4H3,(H2,19,20,25) |
| InChIKey | HVVPTWYKMRDROR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|