C17H23FN4OS — CID 55391316
2-fluoro-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]benzamide (PubChem CID 55391316) has the molecular formula C17H23FN4OS and a molecular weight of 350.46 g/mol. Its IUPAC name is 2-fluoro-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]benzamide.
| Compound Name | 2-fluoro-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]benzamide |
|---|---|
| PubChem CID | 55391316 |
| Molecular Formula | C17H23FN4OS |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 2-fluoro-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]benzamide |
| SMILES | CSc1nnc(CCCNC(=O)c2ccccc2F)n1CC(C)C |
| InChI | InChI=1S/C17H23FN4OS/c1-12(2)11-22-15(20-21-17(22)24-3)9-6-10-19-16(23)13-7-4-5-8-14(13)18/h4-5,7-8,12H,6,9-11H2,1-3H3,(H,19,23) |
| InChIKey | FCAPZLPFJBNJIN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|