C19H29N5OS — CID 119950139
3-amino-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-phenylpropanamide (PubChem CID 119950139) has the molecular formula C19H29N5OS and a molecular weight of 375.54 g/mol. Its IUPAC name is 3-amino-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-phenylpropanamide.
| Compound Name | 3-amino-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 119950139 |
| Molecular Formula | C19H29N5OS |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 3-amino-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-phenylpropanamide |
| SMILES | CSc1nnc(CCCNC(=O)CC(N)c2ccccc2)n1CC(C)C |
| InChI | InChI=1S/C19H29N5OS/c1-14(2)13-24-17(22-23-19(24)26-3)10-7-11-21-18(25)12-16(20)15-8-5-4-6-9-15/h4-6,8-9,14,16H,7,10-13,20H2,1-3H3,(H,21,25) |
| InChIKey | ZVWSUWKMFJVXGH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|