C19H27BrN4OS — CID 60600956
3-(3-bromophenyl)-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]propanamide (PubChem CID 60600956) has the molecular formula C19H27BrN4OS and a molecular weight of 439.42 g/mol. Its IUPAC name is 3-(3-bromophenyl)-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]propanamide.
| Compound Name | 3-(3-bromophenyl)-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]propanamide |
|---|---|
| PubChem CID | 60600956 |
| Molecular Formula | C19H27BrN4OS |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 3-(3-bromophenyl)-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]propanamide |
| SMILES | CSc1nnc(CCCNC(=O)CCc2cccc(Br)c2)n1CC(C)C |
| InChI | InChI=1S/C19H27BrN4OS/c1-14(2)13-24-17(22-23-19(24)26-3)8-5-11-21-18(25)10-9-15-6-4-7-16(20)12-15/h4,6-7,12,14H,5,8-11,13H2,1-3H3,(H,21,25) |
| InChIKey | BBQXLVYQOHSGMR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|