C18H24Cl2N4O2S — CID 55391087
2-(2,4-dichlorophenoxy)-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]acetamide (PubChem CID 55391087) has the molecular formula C18H24Cl2N4O2S and a molecular weight of 431.39 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]acetamide |
|---|---|
| PubChem CID | 55391087 |
| Molecular Formula | C18H24Cl2N4O2S |
| Molecular Weight | 431.39 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]acetamide |
| SMILES | CSc1nnc(CCCNC(=O)COc2ccc(Cl)cc2Cl)n1CC(C)C |
| InChI | InChI=1S/C18H24Cl2N4O2S/c1-12(2)10-24-16(22-23-18(24)27-3)5-4-8-21-17(25)11-26-15-7-6-13(19)9-14(15)20/h6-7,9,12H,4-5,8,10-11H2,1-3H3,(H,21,25) |
| InChIKey | CFHCYUGSKANPDV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|