C17H21Cl3N4O2S — CID 112841656
2,3,5-trichloro-6-hydroxy-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]benzamide (PubChem CID 112841656) has the molecular formula C17H21Cl3N4O2S and a molecular weight of 451.81 g/mol. Its IUPAC name is 2,3,5-trichloro-6-hydroxy-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]benzamide.
| Compound Name | 2,3,5-trichloro-6-hydroxy-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]benzamide |
|---|---|
| PubChem CID | 112841656 |
| Molecular Formula | C17H21Cl3N4O2S |
| Molecular Weight | 451.81 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | 2,3,5-trichloro-6-hydroxy-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]benzamide |
| SMILES | CSc1nnc(CCCNC(=O)c2c(O)c(Cl)cc(Cl)c2Cl)n1CC(C)C |
| InChI | InChI=1S/C17H21Cl3N4O2S/c1-9(2)8-24-12(22-23-17(24)27-3)5-4-6-21-16(26)13-14(20)10(18)7-11(19)15(13)25/h7,9,25H,4-6,8H2,1-3H3,(H,21,26) |
| InChIKey | YTNSMMRGXHAWRU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.81 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|