C19H24ClN5OS — CID 60513219
6-chloro-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-1H-indole-2-carboxamide (PubChem CID 60513219) has the molecular formula C19H24ClN5OS and a molecular weight of 405.96 g/mol. Its IUPAC name is 6-chloro-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-1H-indole-2-carboxamide.
| Compound Name | 6-chloro-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 60513219 |
| Molecular Formula | C19H24ClN5OS |
| Molecular Weight | 405.96 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 6-chloro-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-1H-indole-2-carboxamide |
| SMILES | CSc1nnc(CCCNC(=O)c2cc3ccc(Cl)cc3[nH]2)n1CC(C)C |
| InChI | InChI=1S/C19H24ClN5OS/c1-12(2)11-25-17(23-24-19(25)27-3)5-4-8-21-18(26)16-9-13-6-7-14(20)10-15(13)22-16/h6-7,9-10,12,22H,4-5,8,11H2,1-3H3,(H,21,26) |
| InChIKey | UYFCJUWHTQKFAH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.96 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|