C21H31N5O3S2 — CID 55407895
N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-(2-phenylethenylsulfonylamino)propanamide (PubChem CID 55407895) has the molecular formula C21H31N5O3S2 and a molecular weight of 465.65 g/mol. Its IUPAC name is N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-(2-phenylethenylsulfonylamino)propanamide.
| Compound Name | N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-(2-phenylethenylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 55407895 |
| Molecular Formula | C21H31N5O3S2 |
| Molecular Weight | 465.65 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-(2-phenylethenylsulfonylamino)propanamide |
| SMILES | CSc1nnc(CCCNC(=O)CCNS(=O)(=O)C=Cc2ccccc2)n1CC(C)C |
| InChI | InChI=1S/C21H31N5O3S2/c1-17(2)16-26-19(24-25-21(26)30-3)10-7-13-22-20(27)11-14-23-31(28,29)15-12-18-8-5-4-6-9-18/h4-6,8-9,12,15,17,23H,7,10-11,13-14,16H2,1-3H3,(H,22,27) |
| InChIKey | FGAOLXXRCVLURZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.65 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|