C17H27N3O2S3 — CID 8614358
1-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-3-(3-methylsulfanylpropyl)thiourea (PubChem CID 8614358) has the molecular formula C17H27N3O2S3 and a molecular weight of 401.62 g/mol. Its IUPAC name is 1-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-3-(3-methylsulfanylpropyl)thiourea.
| Compound Name | 1-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-3-(3-methylsulfanylpropyl)thiourea |
|---|---|
| PubChem CID | 8614358 |
| Molecular Formula | C17H27N3O2S3 |
| Molecular Weight | 401.62 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 1-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-3-(3-methylsulfanylpropyl)thiourea |
| SMILES | CSCCCNC(=S)Nc1ccc(C)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C17H27N3O2S3/c1-14-7-8-15(19-17(23)18-9-6-12-24-2)13-16(14)25(21,22)20-10-4-3-5-11-20/h7-8,13H,3-6,9-12H2,1-2H3,(H2,18,19,23) |
| InChIKey | OPIDSSMPHGKJLF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.62 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|