C14H22N4S2 — CID 8618117
1-butyl-3-[(3,4-dimethylphenyl)carbamothioylamino]thiourea (PubChem CID 8618117) has the molecular formula C14H22N4S2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 1-butyl-3-[(3,4-dimethylphenyl)carbamothioylamino]thiourea.
| Compound Name | 1-butyl-3-[(3,4-dimethylphenyl)carbamothioylamino]thiourea |
|---|---|
| PubChem CID | 8618117 |
| Molecular Formula | C14H22N4S2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 1-butyl-3-[(3,4-dimethylphenyl)carbamothioylamino]thiourea |
| SMILES | CCCCNC(=S)NNC(=S)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C14H22N4S2/c1-4-5-8-15-13(19)17-18-14(20)16-12-7-6-10(2)11(3)9-12/h6-7,9H,4-5,8H2,1-3H3,(H2,15,17,19)(H2,16,18,20) |
| InChIKey | VCTNTNRLAVATQB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|