C15H24N4S2 — CID 8655074
1-(3,5-dimethylphenyl)-3-(pentylcarbamothioylamino)thiourea (PubChem CID 8655074) has the molecular formula C15H24N4S2 and a molecular weight of 324.52 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-(pentylcarbamothioylamino)thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-(pentylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 8655074 |
| Molecular Formula | C15H24N4S2 |
| Molecular Weight | 324.52 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-(pentylcarbamothioylamino)thiourea |
| SMILES | CCCCCNC(=S)NNC(=S)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C15H24N4S2/c1-4-5-6-7-16-14(20)18-19-15(21)17-13-9-11(2)8-12(3)10-13/h8-10H,4-7H2,1-3H3,(H2,16,18,20)(H2,17,19,21) |
| InChIKey | ZFPSDKUZJABFCO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|