C16H21ClN4S — CID 17255319
1-[3-(4-chloro-5-methylpyrazol-1-yl)propyl]-3-(3,4-dimethylphenyl)thiourea (PubChem CID 17255319) has the molecular formula C16H21ClN4S and a molecular weight of 336.89 g/mol. Its IUPAC name is 1-[3-(4-chloro-5-methylpyrazol-1-yl)propyl]-3-(3,4-dimethylphenyl)thiourea.
| Compound Name | 1-[3-(4-chloro-5-methylpyrazol-1-yl)propyl]-3-(3,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 17255319 |
| Molecular Formula | C16H21ClN4S |
| Molecular Weight | 336.89 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 1-[3-(4-chloro-5-methylpyrazol-1-yl)propyl]-3-(3,4-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NCCCn2ncc(Cl)c2C)cc1C |
| InChI | InChI=1S/C16H21ClN4S/c1-11-5-6-14(9-12(11)2)20-16(22)18-7-4-8-21-13(3)15(17)10-19-21/h5-6,9-10H,4,7-8H2,1-3H3,(H2,18,20,22) |
| InChIKey | QXFGIUJDKJVHBJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.89 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|