C14H15Cl3N4S — CID 17299784
1-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]-3-(3,4-dichlorophenyl)thiourea (PubChem CID 17299784) has the molecular formula C14H15Cl3N4S and a molecular weight of 377.73 g/mol. Its IUPAC name is 1-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]-3-(3,4-dichlorophenyl)thiourea.
| Compound Name | 1-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]-3-(3,4-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 17299784 |
| Molecular Formula | C14H15Cl3N4S |
| Molecular Weight | 377.73 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 1-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]-3-(3,4-dichlorophenyl)thiourea |
| SMILES | Cc1nn(CCCNC(=S)Nc2ccc(Cl)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C14H15Cl3N4S/c1-9-13(17)8-21(20-9)6-2-5-18-14(22)19-10-3-4-11(15)12(16)7-10/h3-4,7-8H,2,5-6H2,1H3,(H2,18,19,22) |
| InChIKey | LSLZZXVGHCVZGA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.73 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|