C13H14ClFN4S — CID 19573275
1-(3-chloro-4-fluorophenyl)-3-(3-pyrazol-1-ylpropyl)thiourea (PubChem CID 19573275) has the molecular formula C13H14ClFN4S and a molecular weight of 312.80 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-(3-pyrazol-1-ylpropyl)thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-(3-pyrazol-1-ylpropyl)thiourea |
|---|---|
| PubChem CID | 19573275 |
| Molecular Formula | C13H14ClFN4S |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-(3-pyrazol-1-ylpropyl)thiourea |
| SMILES | Fc1ccc(NC(=S)NCCCn2cccn2)cc1Cl |
| InChI | InChI=1S/C13H14ClFN4S/c14-11-9-10(3-4-12(11)15)18-13(20)16-5-1-7-19-8-2-6-17-19/h2-4,6,8-9H,1,5,7H2,(H2,16,18,20) |
| InChIKey | FJHZUANUWCYMLB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|