C13H14ClFN4O — CID 47199081
1-(5-chloro-2-fluorophenyl)-3-(3-pyrazol-1-ylpropyl)urea (PubChem CID 47199081) has the molecular formula C13H14ClFN4O and a molecular weight of 296.73 g/mol. Its IUPAC name is 1-(5-chloro-2-fluorophenyl)-3-(3-pyrazol-1-ylpropyl)urea.
| Compound Name | 1-(5-chloro-2-fluorophenyl)-3-(3-pyrazol-1-ylpropyl)urea |
|---|---|
| PubChem CID | 47199081 |
| Molecular Formula | C13H14ClFN4O |
| Molecular Weight | 296.73 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 1-(5-chloro-2-fluorophenyl)-3-(3-pyrazol-1-ylpropyl)urea |
| SMILES | O=C(NCCCn1cccn1)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C13H14ClFN4O/c14-10-3-4-11(15)12(9-10)18-13(20)16-5-1-7-19-8-2-6-17-19/h2-4,6,8-9H,1,5,7H2,(H2,16,18,20) |
| InChIKey | UJIHVWUWSCEDGH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.73 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|