C16H15Cl2N5O — CID 19510199
3-(2,4-dichlorophenyl)-N-(3-pyrazol-1-ylpropyl)-1H-pyrazole-5-carboxamide (PubChem CID 19510199) has the molecular formula C16H15Cl2N5O and a molecular weight of 364.24 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-(3-pyrazol-1-ylpropyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-(3-pyrazol-1-ylpropyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19510199 |
| Molecular Formula | C16H15Cl2N5O |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-(3-pyrazol-1-ylpropyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCCCn1cccn1)c1cc(-c2ccc(Cl)cc2Cl)n[nH]1 |
| InChI | InChI=1S/C16H15Cl2N5O/c17-11-3-4-12(13(18)9-11)14-10-15(22-21-14)16(24)19-5-1-7-23-8-2-6-20-23/h2-4,6,8-10H,1,5,7H2,(H,19,24)(H,21,22) |
| InChIKey | LVOZJQHKQACLDA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|