C13H13ClFN5O2 — CID 47044330
N'-(5-chloro-2-fluorophenyl)-N-[3-(1,2,4-triazol-1-yl)propyl]oxamide (PubChem CID 47044330) has the molecular formula C13H13ClFN5O2 and a molecular weight of 325.73 g/mol. Its IUPAC name is N'-(5-chloro-2-fluorophenyl)-N-[3-(1,2,4-triazol-1-yl)propyl]oxamide.
| Compound Name | N'-(5-chloro-2-fluorophenyl)-N-[3-(1,2,4-triazol-1-yl)propyl]oxamide |
|---|---|
| PubChem CID | 47044330 |
| Molecular Formula | C13H13ClFN5O2 |
| Molecular Weight | 325.73 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | N'-(5-chloro-2-fluorophenyl)-N-[3-(1,2,4-triazol-1-yl)propyl]oxamide |
| SMILES | O=C(NCCCn1cncn1)C(=O)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C13H13ClFN5O2/c14-9-2-3-10(15)11(6-9)19-13(22)12(21)17-4-1-5-20-8-16-7-18-20/h2-3,6-8H,1,4-5H2,(H,17,21)(H,19,22) |
| InChIKey | WOLBWOPAHQQZJD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.73 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|