C13H16ClFN2O3 — CID 124624749
N'-(4-chloro-2-fluorophenyl)-N-(5-hydroxypentyl)oxamide (PubChem CID 124624749) has the molecular formula C13H16ClFN2O3 and a molecular weight of 302.73 g/mol. Its IUPAC name is N'-(4-chloro-2-fluorophenyl)-N-(5-hydroxypentyl)oxamide.
| Compound Name | N'-(4-chloro-2-fluorophenyl)-N-(5-hydroxypentyl)oxamide |
|---|---|
| PubChem CID | 124624749 |
| Molecular Formula | C13H16ClFN2O3 |
| Molecular Weight | 302.73 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | N'-(4-chloro-2-fluorophenyl)-N-(5-hydroxypentyl)oxamide |
| SMILES | O=C(NCCCCCO)C(=O)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C13H16ClFN2O3/c14-9-4-5-11(10(15)8-9)17-13(20)12(19)16-6-2-1-3-7-18/h4-5,8,18H,1-3,6-7H2,(H,16,19)(H,17,20) |
| InChIKey | GSNABKYCUYWYAO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.73 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|